missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromodiphenylmethane, 90%
CAS: 776-74-9 | C13H11Br | 247.13 g/mol
$81.97 - $81.97
Chemical Identifiers
| CAS | 776-74-9 |
|---|---|
| Molecular Formula | C13H11Br |
| Molecular Weight (g/mol) | 247.13 |
| MDL Number | MFCD00000134 |
| InChI Key | OQROAIRCEOBYJA-UHFFFAOYSA-N |
| Synonym | bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane |
| PubChem CID | 236603 |
| IUPAC Name | [bromo(phenyl)methyl]benzene |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)Br |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC373461000
|
Thermo Scientific Chemicals
373461000 |
100 g |
Each for $81.97
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 776-74-9 | |
| 247.13 | |
| OQROAIRCEOBYJA-UHFFFAOYSA-N | |
| 236603 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Br |
| C13H11Br | |
| MFCD00000134 | |
| bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane | |
| [bromo(phenyl)methyl]benzene |
Specifications
| 776-74-9 | |
| 184.0°C (20.0 mmHg) | |
| 88% min. (GC) | |
| C13H11Br | |
| MFCD00000134 | |
| 05,592 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Br | |
| 247.13 | |
| 247.13 | |
| Bromodiphenylmethane |
| 33.0°C to 42.0°C | |
| >110°C | |
| Glass bottle | |
| (C6H5)2CHBr | |
| 100 g | |
| bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane | |
| OQROAIRCEOBYJA-UHFFFAOYSA-N | |
| [bromo(phenyl)methyl]benzene | |
| 236603 | |
| 90% |
Safety and Handling
GHS Signal Word: Danger
EINECSNumber : 212-279-8
RUO – Research Use Only