missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bromocresol Purple, 0.04% Aqueous, pH 5.3 to 6.8 Yellow to Purple, Certified, LabChem™
Supplier: LabChem LC118907
Specifications
| Bromocresol Purple | |
| 62625-30-3 , 7732-18-5 | |
| C21H15Br2NaO5S | |
| Soluble in water | |
| KVSJYIXUWNOWBD-UGAWPWHASA-M | |
| sodium;2-[(E)-(3-bromo-4-hydroxy-5-methylphenyl)-(3-bromo-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate | |
| 23665568 | |
| Certified | |
| Hydrogen bromide; Carbon monoxide; Carbon dioxide; Sulfur compounds | |
| 125 mL |
| 0.04% Aqueous, pH 5.3 to 6.8 Yellow to Purple | |
| 99.96,0.04 | |
| C21H15BrNaO5S | |
| Passes Test | |
| CC1=CC(=C(C2=CC=CC=C2S(=O)(=O)[O-])C3=CC(=C(C(=C3)Br)O)C)C=C(C1=O)Br.[Na+] | |
| 562.204 | |
| 562.2 | |
| Poly Bottle | |
| Red/Yellow | |
| Liquid |
Chemical Identifiers
| 62625-30-3 | |
| 562.204 | |
| 23665568 | |
| CC1=CC(=C(C2=CC=CC=C2S(=O)(=O)[O-])C3=CC(=C(C(=C3)Br)O)C)C=C(C1=O)Br.[Na+] |
| C21H15Br2NaO5S | |
| KVSJYIXUWNOWBD-UGAWPWHASA-M | |
| sodium;2-[(E)-(3-bromo-4-hydroxy-5-methylphenyl)-(3-bromo-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature