Learn More
Blasticidin S Hydrochloride (From Streptomyces Griseochromogenes), Fisher BioReagents
Supplier: Fisher BioReagents BP2647100
Specifications
| Blasticidin S Hydrochloride | |
| From Streptomyces griseochromogenes | |
| 3-9-3513 | |
| Amber Glass | |
| White | |
| ≥99.0 % | |
| BLA-S, Cytovirin | |
| CN(CCC(CC(=O)NC1C=CC(OC1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N.Cl | |
| 458.90 | |
| 458.69 |
| Blasticidin S Hydrochloride | |
| Powder/Solid | |
| 248°C | |
| 900μg/mg min. | |
| 100 mg | |
| C17H27ClN8O5 | |
| YQXYQOXRCNEATG-UHFFFAOYNA-N | |
| (2R,3S,6S)-3-[[(3R)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-2-carboxylic acid;hydrochloride | |
| 124080960 | |
| 99.0% min. |
Chemical Identifiers
| 3-9-3513 | |
| 458.90 | |
| BLA-S, Cytovirin | |
| (2R,3S,6S)-3-[[(3R)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2H-pyran-2-carboxylic acid;hydrochloride |
| C17H27ClN8O5 | |
| YQXYQOXRCNEATG-UHFFFAOYNA-N | |
| 124080960 | |
| CN(CCC(CC(=O)NC1C=CC(OC1C(=O)O)N2C=CC(=NC2=O)N)N)C(=N)N.Cl |
Safety and Handling
DANGER!
Emergency Overview
May be fatal if swallowed. May cause skin, eye, and respiratory tract irritation. Use personal protective equipment. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Immediate medical attention is required. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Immediate medical attention is required. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Immediate medical attention is required. Immediate medical attention is required. Do not induce vomiting.
NFPA
Health:4
Flammability:0
Instability:0
Recommended Storage : 0° to 5°C