missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bis(2,4,6-trichlorophenyl) Oxalate 98.0+%, TCI America™
[Chemiluminescence reagent for the determination of fluorescent compounds]
Supplier: TCI America A53021G
Specifications
| Bis(2,4,6-trichlorophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent c | |
| 190°C | |
| C14H4Cl6O4 | |
| 1 g | |
| GEVPIWPYWJZSPR-UHFFFAOYSA-N | |
| bis(2,4,6-trichlorophenyl) oxalate | |
| 160567 | |
| ≥98.0% (T) |
| 1165-91-9 | |
| White | |
| MFCD00043061 | |
| bis 2,4,6-trichlorophenyl oxalate, bis 2,4,6-trichlorophenyl ethanedioate, oxalic acid bis 2,4,6-trichlorophenyl ester, 2,4,6-trichlorophenyl oxalate, ethanedioic acid, bis 2,4,6-trichlorophenyl ester, bis-tcpo, acmc-20a7jt, gevpiwpywjzspr-uhfffaoysa | |
| C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl | |
| 448.882 | |
| 448.88 | |
| Crystalline Powder |
Chemical Identifiers
| 1165-91-9 | |
| 448.882 | |
| GEVPIWPYWJZSPR-UHFFFAOYSA-N | |
| 160567 | |
| C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl |
| C14H4Cl6O4 | |
| MFCD00043061 | |
| bis 2,4,6-trichlorophenyl oxalate, bis 2,4,6-trichlorophenyl ethanedioate, oxalic acid bis 2,4,6-trichlorophenyl ester, 2,4,6-trichlorophenyl oxalate, ethanedioic acid, bis 2,4,6-trichlorophenyl ester, bis-tcpo, acmc-20a7jt, gevpiwpywjzspr-uhfffaoysa | |
| bis(2,4,6-trichlorophenyl) oxalate |
Safety and Handling
TSCA : No