missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Bicine, ULTROL™ Grade, Calbiochem™,
A zwitterionic amino acid buffer active in the pH 7.6 to 9.0 range
Supplier: MilliporeSigma™ 3913361KG
Specifications
| 5%, H2O, 250nm | |
| 150-25-4 | |
| by titration | |
| C6H12NNaO4 | |
| N,N-bis-(2-Hydroxyethyl)glycine | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| sodium 2-[bis(2-hydroxyethyl)amino]acetate | |
| 8761 | |
| 163.2 |
| zwitterionic amino acid buffer | |
| 1 kg | |
| ≥99.0% | |
| MFCD00004295 | |
| Easily soluble in cold water | |
| [Na+].OCCN(CCO)CC([O-])=O | |
| 185.16 | |
| CHEBI:40957 | |
| ULTROL |
Chemical Identifiers
| 150-25-4 | |
| 185.16 | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| 8761 | |
| sodium 2-[bis(2-hydroxyethyl)amino]acetate |
| C6H12NNaO4 | |
| MFCD00004295 | |
| N,N-bis-(2-Hydroxyethyl)glycine | |
| CHEBI:40957 | |
| [Na+].OCCN(CCO)CC([O-])=O |
Safety and Handling
Recommended Storage : 15°C to 30°C (Do not freeze); Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above 20°C (68°F).