missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Bevantolol hydrochloride, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468872500
Specifications
| Bevantolol hydrochloride | |
| Available | |
| Titration Argentometric | |
| C20H28ClNO4 | |
| 00941389 | |
| 225°C to 228°C | |
| Slightly soluble in water; Soluble in methanol and chloroform; Insoluble in ether, ethyl acetate and hexane | |
| [H+].[Cl-].COC1=CC=C(CCNCC(O)COC2=CC=CC(C)=C2)C=C1OC | |
| 381.90 | |
| 381.9 |
| Glass Bottle | |
| 42864-78-8 | |
| Powder | |
| 97.5% to 102.5% | |
| White to Yellow to Beige | |
| 1194 | |
| FJTKCFSPYUMXJB-UHFFFAOYNA-N | |
| hydrogen 1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-(3-methylphenoxy)propan-2-ol chloride | |
| 250 mg |
Chemical Identifiers
| 42864-78-8 | |
| 381.90 | |
| FJTKCFSPYUMXJB-UHFFFAOYNA-N | |
| [H+].[Cl-].COC1=CC=C(CCNCC(O)COC2=CC=CC(C)=C2)C=C1OC |
| C20H28ClNO4 | |
| 00941389 | |
| hydrogen 1-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-3-(3-methylphenoxy)propan-2-ol chloride |
Safety and Handling
GHS07: Exclamation mark
ShelfLife : 5 years
RTECSNumber : UB2709000
Recommended Storage : Refrigerator +4°C