missing translation for 'onlineSavingsMsg'
Learn More
Learn More
beta-Naphthoflavone, 99+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 128170050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| β-Naphthoflavone | |
| 6051-87-2 | |
| 100.0 | |
| 99% min. (HPLC) | |
| C19H12O2 | |
| 5g | |
| beta-naphthoflavone, 5,6-benzoflavone, beta-nf, 3-phenyl-1h-naphtho 2,1-b pyran-1-one, 3-phenyl-1h-benzo f chromen-1-one, 1h-naphtho 2,1-b pyran-1-one, 3-phenyl, unii-1bt0256y8o, 3-phenylbenzo f chromen-1-one, ccris 3262, .beta.-naphthoflavone | |
| OUGIDAPQYNCXRA-UHFFFAOYSA-N | |
| 3-phenylbenzo[f]chromen-1-one | |
| 2361 | |
| 272.29 |
| 99+% | |
| 99.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00004986 | |
| 17, I, 216 | |
| Solubility in water: insoluble. Other solubilities: slightly soluble in ethanol,chloroform,soluble in sulfuric acid | |
| C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC4=CC=CC=C43 | |
| 272.29 | |
| CHEBI:77013 | |
| 99+% |
Chemical Identifiers
| 6051-87-2 | |
| 272.29 | |
| OUGIDAPQYNCXRA-UHFFFAOYSA-N | |
| 2361 | |
| 3-phenylbenzo[f]chromen-1-one |
| C19H12O2 | |
| MFCD00004986 | |
| beta-naphthoflavone, 5,6-benzoflavone, beta-nf, 3-phenyl-1h-naphtho 2,1-b pyran-1-one, 3-phenyl-1h-benzo f chromen-1-one, 1h-naphtho 2,1-b pyran-1-one, 3-phenyl, unii-1bt0256y8o, 3-phenylbenzo f chromen-1-one, ccris 3262, .beta.-naphthoflavone | |
| CHEBI:77013 | |
| C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC4=CC=CC=C43 |
Safety and Handling
EINECSNumber : 227-958-4
RTECSNumber : QL6200000
TSCA : TSCA
RUO â Research Use Only