missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzyl ether, 99%
CAS: 103-50-4 | C14H14O | 198.26 g/mol
$94.10 - $208.70
Chemical Identifiers
| CAS | 103-50-4 |
|---|---|
| Molecular Formula | C14H14O |
| Molecular Weight (g/mol) | 198.26 |
| MDL Number | MFCD00004780 |
| InChI Key | MHDVGSVTJDSBDK-UHFFFAOYSA-N |
| Synonym | dibenzyl ether, benzyl ether, benzyl oxide, dibenzylether, oxybis methylene dibenzene, plastikator ba, ba plasticizer, benzylether, ether, dibenzyl, plasticator baShow More |
| PubChem CID | 7657 |
| ChEBI | CHEBI:87411 |
| IUPAC Name | phenylmethoxymethylbenzene |
| SMILES | C1=CC=C(C=C1)COCC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC148400010
|
Thermo Scientific Chemicals
148400010 |
1 L | Glass bottle |
Each for $94.10
|
|
||||
|
AC148400025
|
Thermo Scientific Chemicals
148400025 |
2.5 L | Glass bottle |
Each for $208.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 103-50-4 | |
| 198.26 | |
| MHDVGSVTJDSBDK-UHFFFAOYSA-N | |
| 7657 | |
| phenylmethoxymethylbenzene |
| C14H14O | |
| MFCD00004780 | |
| dibenzyl ether, benzyl ether, benzyl oxide, dibenzylether, oxybis methylene dibenzene, plastikator ba, ba plasticizer, benzylether, ether, dibenzyl, plasticator baShow More | |
| CHEBI:87411 | |
| C1=CC=C(C=C1)COCC2=CC=CC=C2 |
Specifications
| 103-50-4 | |
| 100.0 | |
| Colorless to Yellow | |
| 298.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5610 to 1.5630 | |
| MFCD00004780 | |
| 06, 434 | |
| 15, 1135 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether,acetone and chloroform | |
| C1=CC=C(C=C1)COCC2=CC=CC=C2 | |
| 198.26 | |
| CHEBI:87411 | |
| 99% | |
| Benzyl ether, 99% |
| 98.5 | |
| 1.5°C to 3.5°C | |
| 1.0400g/mL | |
| 135°C | |
| 99% | |
| C14H14O | |
| (C6H5CH2)2O | |
| 1 L | |
| 1.04 | |
| dibenzyl ether, benzyl ether, benzyl oxide, dibenzylether, oxybis methylene dibenzene, plastikator ba, ba plasticizer, benzylether, ether, dibenzyl, plasticator ba | |
| MHDVGSVTJDSBDK-UHFFFAOYSA-N | |
| phenylmethoxymethylbenzene | |
| 7657 | |
| 198.26 | |
| Liquid |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/attention.
GHS Signal Word: Warning
EINECSNumber : 203-118-2
RTECSNumber : DQ6125000
TSCA : TSCA
RUO – Research Use Only