missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzyl ether, 99%, ACROS Organics™
$63.72 - $152.73
Chemical Identifiers
| CAS | 103-50-4 |
|---|---|
| Molecular Formula | C14H14O |
| Molecular Weight (g/mol) | 198.26 |
| MDL Number | MFCD00004780 |
| InChI Key | MHDVGSVTJDSBDK-UHFFFAOYSA-N |
| Synonym | ba plasticizer, benzyl ether, benzyl oxide, benzylether, dibenzyl ether, dibenzylether, ether, dibenzyl, oxybis methylene dibenzene, plasticator ba, plastikator ba |
| PubChem CID | 7657 |
| ChEBI | CHEBI:87411 |
| IUPAC Name | phenylmethoxymethylbenzene |
| SMILES | C1=CC=C(C=C1)COCC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC148400010
|
Fisher Scientific Acros
148400010 |
1L | Glass bottle |
Each for $63.72
|
|
AC148400025
|
Thermo Fisher Scientific
148400025 |
2.5L | Glass bottle |
Each for $152.73
|
|
Chemical Identifiers
| 103-50-4 | |
| 198.26 | |
| MHDVGSVTJDSBDK-UHFFFAOYSA-N | |
| 7657 | |
| phenylmethoxymethylbenzene |
| C14H14O | |
| MFCD00004780 | |
| ba plasticizer, benzyl ether, benzyl oxide, benzylether, dibenzyl ether, dibenzylether, ether, dibenzyl, oxybis methylene dibenzene, plasticator ba, plastikator ba | |
| CHEBI:87411 | |
| C1=CC=C(C=C1)COCC2=CC=CC=C2 |
Specifications
| 1.0400g/mL | |
| Authentic | |
| 1.5610 to 1.5630 | |
| 298.0°C | |
| 1.5°C to 3.5°C | |
| 103-50-4 | |
| 100.0 | |
| C14H14O | |
| MFCD00004780 | |
| 15, 1135 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether,acetone and chloroform | |
| C1=CC=C(C=C1)COCC2=CC=CC=C2 | |
| 198.26 | |
| CHEBI:87411 | |
| Liquid | |
| Benzyl ether, 99% |
| 135°C | |
| Glass bottle | |
| 1.04 | |
| Colorless to Yellow | |
| 1L | |
| 98.5 | |
| 99% | |
| (C6H5CH2)2O | |
| 06, 434 | |
| ba plasticizer, benzyl ether, benzyl oxide, benzylether, dibenzyl ether, dibenzylether, ether, dibenzyl, oxybis methylene dibenzene, plasticator ba, plastikator ba | |
| MHDVGSVTJDSBDK-UHFFFAOYSA-N | |
| phenylmethoxymethylbenzene | |
| 7657 | |
| 198.26 | |
| 99% |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/attention.
GHS Signal Word: Warning
EINECSNumber : 203-118-2
RTECSNumber : DQ6125000
TSCA : TSCA