Learn More
Benzyl benzoate, 99+%
CAS: 120-51-4 | C14H12O2 | 212.25 g/mol
Supplier: Thermo Scientific Chemicals 105862500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Benzyl benzoate | |
| 0.3mg KOH/g max. | |
| 100.0 | |
| Colorless | |
| 323.0°C | |
| Authentic | |
| Glass bottle | |
| 1.5670 to 1.5700 | |
| MFCD00003075 | |
| 09, 121 | |
| 15, 1130 | |
| Solubility in water: 15.3mg/l (20°C). Other solubilities: soluble in alcohol,chloroform and ether,insoluble in glycerol | |
| O=C(OCC1=CC=CC=C1)C1=CC=CC=C1 | |
| 212.25 | |
| 10.9 mPa.s (25°C) | |
| 212.25 | |
| Liquid |
| 120-51-4 | |
| 99.0 | |
| 18.0°C to 20.0°C | |
| 1.1180g/mL | |
| 147°C | |
| 99% min. (GC) | |
| C14H12O2 | |
| C6H5CO2CH2C6H5 | |
| 250 mL | |
| 1.118 | |
| ascabiol, benylate, novoscabin, benzoic acid, phenylmethyl ester, scabitox, scobenol, ascabin, benzyl phenylformate, benzoic acid, benzyl ester, phenylmethyl benzoate | |
| SESFRYSPDFLNCH-UHFFFAOYSA-N | |
| benzyl benzoate | |
| 2345 | |
| CHEBI:41237 | |
| 99+% |
Chemical Identifiers
| 120-51-4 | |
| 212.25 | |
| SESFRYSPDFLNCH-UHFFFAOYSA-N | |
| 2345 | |
| benzyl benzoate |
| C14H12O2 | |
| MFCD00003075 | |
| ascabiol, benylate, novoscabin, benzoic acid, phenylmethyl ester, scabitox, scobenol, ascabin, benzyl phenylformate, benzoic acid, benzyl ester, phenylmethyl benzoate | |
| CHEBI:41237 | |
| O=C(OCC1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Toxic to aquatic life with long lasting effects.
Very toxic to aquatic life.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wash face,hands and any exposed skin thoroughly after handling.
Avoid release to the environment.
GHS Signal Word: Warning
EINECSNumber : 204-402-9
RUO – Research Use Only