missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzophenone hydrazone, 98+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 105570050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Benzophenone hydrazone | |
| 98.0 | |
| 225°C to 230°C (55.0mmHg) | |
| 98+% | |
| C13H12N2 | |
| MFCD00007624 | |
| 07, 417 | |
| benzophenone hydrazone, diphenylmethylene hydrazine, benzophenonehydrazone, methanone, diphenyl-, hydrazone, diphenylmethanone hydrazone, benzophenone, hydrazone, diphenylmethylidene hydrazine, diphenyl ketone hydrazone, benzophenone hydrozone, nsc 43 | |
| C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 | |
| 196.25 | |
| 196.25 |
| 5350-57-2 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| (C6H5)2C=NNH2 | |
| 5g | |
| 13,242 | |
| QYCSNMDOZNUZIT-UHFFFAOYSA-N | |
| benzhydrylidenehydrazine | |
| 79304 | |
| 98+% |
Chemical Identifiers
| 5350-57-2 | |
| 196.25 | |
| QYCSNMDOZNUZIT-UHFFFAOYSA-N | |
| 79304 | |
| C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
| C13H12N2 | |
| MFCD00007624 | |
| benzophenone hydrazone, diphenylmethylene hydrazine, benzophenonehydrazone, methanone, diphenyl-, hydrazone, diphenylmethanone hydrazone, benzophenone, hydrazone, diphenylmethylidene hydrazine, diphenyl ketone hydrazone, benzophenone hydrozone, nsc 43 | |
| benzhydrylidenehydrazine |
Safety and Handling
EINECSNumber : 226-321-8
RUO â Research Use Only