missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzophenone hydrazone, 98+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 105575000
| Quantity | 500g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C13H12N2 | |
| MFCD00007624 | |
| benzophenone hydrazone, diphenylmethylene hydrazine, benzophenonehydrazone, methanone, diphenyl-, hydrazone, diphenylmethanone hydrazone, benzophenone, hydrazone, diphenylmethylidene hydrazine, diphenyl ketone hydrazone, benzophenone hydrozone, nsc 43 | |
| benzhydrylidenehydrazine |
Specifications
| Benzophenone hydrazone | |
| 98.0 | |
| 225°C to 230°C (55.0mmHg) | |
| 98+% | |
| C13H12N2 | |
| 500g | |
| 07, 417 | |
| benzophenone hydrazone, diphenylmethylene hydrazine, benzophenonehydrazone, methanone, diphenyl-, hydrazone, diphenylmethanone hydrazone, benzophenone, hydrazone, diphenylmethylidene hydrazine, diphenyl ketone hydrazone, benzophenone hydrozone, nsc 43 | |
| C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 | |
| 196.25 | |
| 196.25 |
| 5350-57-2 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| (C6H5)2C=NNH2 | |
| MFCD00007624 | |
| 13,242 | |
| QYCSNMDOZNUZIT-UHFFFAOYSA-N | |
| benzhydrylidenehydrazine | |
| 79304 | |
| 98+% |
Safety and Handling
EINECSNumber : 226-321-8