missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzethonium Chloride 97.0+%, TCI America™
Supplier: TCI America B004425G
Specifications
| Benzethonium Chloride | |
| 163°C | |
| 4.8 to 5.5 (1% H2O soln.) | |
| MFCD00011742 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] | |
| 448.088 | |
| CHEBI:31264 | |
| ≥97.0% (HPLC) |
| 121-54-0 | |
| White | |
| C27H42ClNO2 | |
| 25 g | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride | |
| 8478 | |
| 448.09 | |
| Crystalline Powder |
Chemical Identifiers
| 121-54-0 | |
| 448.088 | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| 8478 | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |
| C27H42ClNO2 | |
| MFCD00011742 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| CHEBI:31264 | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
Safety and Handling
EINECSNumber : (9)-0252&(3)-2782&(9)-0849
RTECSNumber : BO7175000
TSCA : Yes