Learn More
Benzbromarone, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 460900010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Benzbromarone | |
| 0.5% max. | |
| 97.5% min. (GC) | |
| C17H12Br2O3 | |
| benzbromarone, benzbromaron, desuric, urinorm, normurat, uricovac, minuric, exurate, hipurik, azubromaron | |
| WHQCHUCQKNIQEC-UHFFFAOYSA-N | |
| (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone | |
| 2333 | |
| 424.08 |
| 3562-84-3 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| Solubility in water: .. Other solubilities: soluble in hot methanol | |
| CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)Br)O)Br | |
| 424.08 | |
| CHEBI:3023 | |
| 98% |
Chemical Identifiers
| 3562-84-3 | |
| 424.08 | |
| benzbromarone, benzbromaron, desuric, urinorm, normurat, uricovac, minuric, exurate, hipurik, azubromaron | |
| CHEBI:3023 | |
| CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)Br)O)Br |
| C17H12Br2O3 | |
| WHQCHUCQKNIQEC-UHFFFAOYSA-N | |
| 2333 | |
| (3,5-dibromo-4-hydroxyphenyl)-(2-ethyl-1-benzofuran-3-yl)methanone |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement Wash face, hands and any exposed skin thoroughly after handling. IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 222-630-7
RUO â Research Use Only