missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzanilide, 98%, Thermo Scientific Chemicals
$40.43 - $134.16
Chemical Identifiers
| CAS | 93-98-1 |
|---|---|
| Molecular Formula | C13H11NO |
| Molecular Weight (g/mol) | 197.24 |
| MDL Number | MFCD00003069 |
| InChI Key | ZVSKZLHKADLHSD-UHFFFAOYSA-N |
| Synonym | benzanilide, n-benzoylaniline, benzamide, n-phenyl, n-phenyl-benzamide, benzoic acid anilide, unii-ak1b12366o, phenyl-n-benzamide, benzanilid, benzoylanilide, n-benzoyl aniline |
| PubChem CID | 7168 |
| IUPAC Name | N-phenylbenzamide |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC148550500
|
Thermo Scientific Chemicals
148550500 |
50 g | Plastic bottle |
Each for $40.43
|
|
||||
|
AC148552500
|
Thermo Scientific Chemicals
148552500 |
250 g | Plastic bottle |
Each for $134.16
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 93-98-1 | |
| 197.24 | |
| ZVSKZLHKADLHSD-UHFFFAOYSA-N | |
| 7168 | |
| C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 |
| C13H11NO | |
| MFCD00003069 | |
| benzanilide, n-benzoylaniline, benzamide, n-phenyl, n-phenyl-benzamide, benzoic acid anilide, unii-ak1b12366o, phenyl-n-benzamide, benzanilid, benzoylanilide, n-benzoyl aniline | |
| N-phenylbenzamide |
Specifications
| 93-98-1 | |
| 100.0 | |
| Gray to Green-Yellow | |
| Authentic | |
| Plastic bottle | |
| C6H5CONHC6H5 | |
| 50 g | |
| 15, 1063 | |
| Solubility in water: insoluble. Other solubilities: 1g/60 mL alcohol,1g/7 mL boiling alcohol,slightly soluble in ether,acetic acid | |
| C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 | |
| 197.24 | |
| 197.24 | |
| Powder |
| 97.5 | |
| 161°C to 165°C | |
| 117°C (10.0mmHg) | |
| 97.5% min. (HPLC) | |
| C13H11NO | |
| MFCD00003069 | |
| 12, 262 | |
| benzanilide, n-benzoylaniline, benzamide, n-phenyl, n-phenyl-benzamide, benzoic acid anilide, unii-ak1b12366o, phenyl-n-benzamide, benzanilid, benzoylanilide, n-benzoyl aniline | |
| ZVSKZLHKADLHSD-UHFFFAOYSA-N | |
| N-phenylbenzamide | |
| 7168 | |
| 98% | |
| Benzanilide, 98% |
Safety and Handling
EINECSNumber : 202-292-7
TSCA : TSCA
RUO â Research Use Only