missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Benzanilide, 98%
CAS: 93-98-1 | C13H11NO | 197.24 g/mol
Supplier: Thermo Scientific Chemicals 148550500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Benzanilide | |
| 93-98-1 | |
| 100.0 | |
| Gray to Green-Yellow | |
| Authentic | |
| Plastic bottle | |
| C6H5CONHC6H5 | |
| 50 g | |
| 15, 1063 | |
| Solubility in water: insoluble. Other solubilities: 1g/60 mL alcohol,1g/7 mL boiling alcohol,slightly soluble in ether,acetic acid | |
| C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 | |
| 197.24 | |
| 197.24 | |
| Powder |
| 98% | |
| 97.5 | |
| 161°C to 165°C | |
| 117°C (10.0 mmHg) | |
| 97.5% min. (HPLC) | |
| C13H11NO | |
| MFCD00003069 | |
| 12, 262 | |
| benzanilide, n-benzoylaniline, benzamide, n-phenyl, n-phenyl-benzamide, benzoic acid anilide, unii-ak1b12366o, phenyl-n-benzamide, benzanilid, benzoylanilide, n-benzoyl aniline | |
| ZVSKZLHKADLHSD-UHFFFAOYSA-N | |
| N-phenylbenzamide | |
| 7168 | |
| 98% |
Chemical Identifiers
| 93-98-1 | |
| 197.24 | |
| ZVSKZLHKADLHSD-UHFFFAOYSA-N | |
| 7168 | |
| C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2 |
| C13H11NO | |
| MFCD00003069 | |
| benzanilide, n-benzoylaniline, benzamide, n-phenyl, n-phenyl-benzamide, benzoic acid anilide, unii-ak1b12366o, phenyl-n-benzamide, benzanilid, benzoylanilide, n-benzoyl aniline | |
| N-phenylbenzamide |
Safety and Handling
EINECSNumber : 202-292-7
TSCA : TSCA
RUO – Research Use Only