missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Barium Nitrate, Crystal, ACS, 99%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor B104512KG
Specifications
| 10022-31-8 | |
| 5.0 to 8.0 | |
| BaN2O6 | |
| IWOUKMZUPDVPGQ-UHFFFAOYSA-N | |
| barium(2+) dinitrate | |
| 99% | |
| Poly Pail |
| 1 | |
| 12 kg | |
| MFCD00003442 | |
| [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 261.34 | |
| ACS |
Chemical Identifiers
| 10022-31-8 | |
| 261.34 | |
| IWOUKMZUPDVPGQ-UHFFFAOYSA-N | |
| [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| BaN2O6 | |
| MFCD00003442 | |
| barium(2+) dinitrate |
CAUTION: For manufacturing or laboratory use only. Not for food or drug use. Read and understand the label and Safety Data Sheet (SDS) prior to use.