missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Atovaquone, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468762500
Specifications
| Atovaquone | |
| Available | |
| Powder | |
| 00889188 | |
| 221°C to 225°C | |
| BSJMWHQBCZFXBR-UHFFFAOYSA-N | |
| 3-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-1,2-dihydronaphthalene-1,2-dione | |
| 250 mg |
| Glass Bottle | |
| 95233-18-4 | |
| C22H19ClO3 | |
| Yellow to Dark Yellow | |
| Soluble in THF; Slightly soluble in acetone; Insoluble in methanol and water | |
| OC1=C(C2CCC(CC2)C2=CC=C(Cl)C=C2)C(=O)C(=O)C2=CC=CC=C12 | |
| 366.84 |
Chemical Identifiers
| 95233-18-4 | |
| 366.84 | |
| BSJMWHQBCZFXBR-UHFFFAOYSA-N | |
| OC1=C(C2CCC(CC2)C2=CC=C(Cl)C=C2)C(=O)C(=O)C2=CC=CC=C12 |
| C22H19ClO3 | |
| 00889188 | |
| 3-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxy-1,2-dihydronaphthalene-1,2-dione |
Safety and Handling
Recommended Storage : Normal conditions