missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Arginine Hydrochloride, USP, 98.5-101.5%, Spectrum™ Chemical
A1337, 1119-34-2, C6H14N4O2·HCl
Supplier: Spectrum Chemical Mfg Cor A13371KG
Description
Spectrum™ Chemical Arginine Hydrochloride, USP is a semiessential amino acid that has an important part in wound healing. All Spectrum Chemical USP products are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 1119-34-2 | |
| 0.1% | |
| C6H15ClN4O2 | |
| +21.4° to +23.6° | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| hydrogen (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid chloride | |
| 210.66 | |
| USP |
| 100% | |
| 0.2% | |
| Poly Bottle | |
| 0.03% | |
| [H+].[Cl-].N[C@@H](CCCN=C(N)N)C(O)=O | |
| 1 kg | |
| 98.5 to 101.5% |
Chemical Identifiers
| 1119-34-2 | |
| 210.66 | |
| hydrogen (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid chloride |
| C6H15ClN4O2 | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| [H+].[Cl-].N[C@@H](CCCN=C(N)N)C(O)=O |