missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
alpha-Bromodiphenylmethane 97.0+%, TCI America™
$66.37 - $585.63
Chemical Identifiers
| CAS | 776-74-9 |
|---|---|
| Molecular Formula | C13H11Br |
| Molecular Weight (g/mol) | 247.135 |
| MDL Number | MFCD00000134 |
| InChI Key | OQROAIRCEOBYJA-UHFFFAOYSA-N |
| Synonym | bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane |
| PubChem CID | 236603 |
| IUPAC Name | [bromo(phenyl)methyl]benzene |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)Br |
Chemical Identifiers
| 776-74-9 | |
| 247.135 | |
| OQROAIRCEOBYJA-UHFFFAOYSA-N | |
| 236603 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Br |
| C13H11Br | |
| MFCD00000134 | |
| bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane | |
| [bromo(phenyl)methyl]benzene |
Specifications
| 776-74-9 | |
| 193°C | |
| MFCD00000134 | |
| 1770 | |
| OQROAIRCEOBYJA-UHFFFAOYSA-N | |
| [bromo(phenyl)methyl]benzene | |
| 236603 | |
| ≥97.0% (GC,T) | |
| alpha-Bromodiphenylmethane |
| 39°C | |
| C13H11Br | |
| 25 g | |
| bromodiphenylmethane, benzhydryl bromide, diphenylmethyl bromide, diphenylbromomethane, alpha-bromodiphenylmethane, bromo phenyl methyl benzene, benzene, 1,1'-bromomethylene bis, methane, bromodiphenyl, bromomethylene dibenzene, bromodiphenyl methane | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)Br | |
| 247.135 | |
| 247.14 | |
| Crystalline Lumps |
Safety and Handling
RTECSNumber : PA5350000
TSCA : Yes
Recommended Storage : Refrigerator