missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Alizarin Red S (Sodium Sulfonate), MP Biomedicals™
Alizarin red S is used in a biochemical assay to determine, quantitatively by colorimetry, the presence of calcific deposition by cells of an osteogenic lineage
$96.49 - $1,175.20
Chemical Identifiers
| CAS | 130-22-3 |
|---|---|
| Molecular Formula | C14H7NaO7S |
| Molecular Weight (g/mol) | 342.253 |
| MDL Number | MFCD00013049 |
| InChI Key | HFVAFDPGUJEFBQ-UHFFFAOYSA-M |
| Synonym | Alizarin sodium sulfonate, Sodium Alizarinsulfonate |
| PubChem CID | 3955344 |
| ChEBI | CHEBI:87358 |
| IUPAC Name | sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
| ICN10037525 |
Mp Biomedicals
10037525 |
25g |
Each for $96.49
|
|
ICN10037580 |
Mp Biomedicals
10037580 |
100g |
Each for $305.75
|
|
ICN10037590 |
Mp Biomedicals
10037590 |
500g |
Each for $1,175.20
|
|
Chemical Identifiers
| 130-22-3 | |
| 342.253 | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| 3955344 | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| C14H7NaO7S | |
| MFCD00013049 | |
| Alizarin sodium sulfonate, Sodium Alizarinsulfonate | |
| CHEBI:87358 | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |
Specifications
| 130-22-3 | |
| MFCD00013049 | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate | |
| 3955344 | |
| 342.3 | |
| Orange | |
| Alizarin Red S, Indicator: pH Range 3.7 - 5.2 |
| C14H7NaO7S | |
| Alizarin sodium sulfonate, Sodium Alizarinsulfonate | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] | |
| 342.253 | |
| CHEBI:87358 | |
| Powder | |
| 25g |
Safety and Handling
EINECSNumber : 204-981-8
Recommended Storage : Store at Room Temperature (15-30°C).