missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Alizarin Red S (Sodium Sulfonate), MP Biomedicals™
Alizarin red S is used in a biochemical assay to determine, quantitatively by colorimetry, the presence of calcific deposition by cells of an osteogenic lineage
Supplier: MP Biomedicals Inc 0210037590
Specifications
| Alizarin Red S | |
| 130-22-3 | |
| MFCD00013049 | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate | |
| 3955344 | |
| 342.3 | |
| 500 g |
| Indicator: pH Range 3.7 - 5.2 | |
| C14H7NaO7S | |
| Sodium Alizarinsulfonate, Alizarin sodium sulfonate | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] | |
| 342.253 | |
| CHEBI:87358 | |
| Orange | |
| Powder |
Chemical Identifiers
| 130-22-3 | |
| 342.253 | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| 3955344 | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| C14H7NaO7S | |
| MFCD00013049 | |
| Sodium Alizarinsulfonate, Alizarin sodium sulfonate | |
| CHEBI:87358 | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |
Safety and Handling
EINECSNumber : 204-981-8
Recommended Storage : Store at Room Temperature (15-30°C).