missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Alizarin Red S Indicator, 1% (w/v), Ricca Chemical
Supplier: Ricca Chemical Company RI50016
Specifications
| Alizarin Red S Indicator | |
| 97.0,0.97 | |
| 1% (w/v) | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate | |
| 3955344 | |
| Natural Poly Bottle | |
| Red | |
| Liquid |
| 130-22-3,7732-18-5 | |
| 100.0,1.01 | |
| C14H7NaO7S | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] | |
| 342.253 | |
| CHEBI:87358 | |
| Aqueous Solution | |
| 500 mL |
Chemical Identifiers
| 130-22-3 | |
| 342.253 | |
| 3955344 | |
| sodium;3,4-dihydroxy-9,10-dioxoanthracene-2-sulfonate |
| C14H7NaO7S | |
| HFVAFDPGUJEFBQ-UHFFFAOYSA-M | |
| CHEBI:87358 | |
| C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)[O-].[Na+] |