missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Acid Blue 29, MP Biomedicals™
Supplier: MP Biomedicals Inc 0215259625
Description
Stains and dyesSpecifications
| Acid Blue 29 | |
| C22H14N6Na2O9S2 | |
| C.I. 20460 | |
| [Na+].[Na+].NC1=C(N=NC2=CC=CC(=C2)[N+]([O-])=O)C(=CC2=C1C(=O)\C(=N/NC1=CC=CC=C1)C(=C2)S([O-])(=O)=O)S([O-])(=O)=O | |
| 616.49 | |
| 616.5 | |
| 25 g |
| 5850-35-1 | |
| MFCD00009960 | |
| WEILTBATXPPXPP-AXSRUCDFSA-L | |
| disodium (3E)-5-amino-6-[2-(3-nitrophenyl)diazen-1-yl]-4-oxo-3-(2-phenylhydrazin-1-ylidene)-3,4-dihydronaphthalene-2,7-disulfonate | |
| 44134491 | |
| Black | |
| Powder |
Chemical Identifiers
| 5850-35-1 | |
| 616.49 | |
| WEILTBATXPPXPP-AXSRUCDFSA-L | |
| 44134491 | |
| [Na+].[Na+].NC1=C(N=NC2=CC=CC(=C2)[N+]([O-])=O)C(=CC2=C1C(=O)\C(=N/NC1=CC=CC=C1)C(=C2)S([O-])(=O)=O)S([O-])(=O)=O |
| C22H14N6Na2O9S2 | |
| MFCD00009960 | |
| C.I. 20460 | |
| disodium (3E)-5-amino-6-[2-(3-nitrophenyl)diazen-1-yl]-4-oxo-3-(2-phenylhydrazin-1-ylidene)-3,4-dihydronaphthalene-2,7-disulfonate |
Safety and Handling
EINECSNumber : 227-449-7
Recommended Storage : Store at Room Temperature (15° to 30°C)