missing translation for 'onlineSavingsMsg'
Learn More
Learn More
6-Ethoxy-2-naphthaleneboronic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 440230010
| Quantity | 1g |
|---|
Chemical Identifiers
| 352525-98-5 | |
| 216.04 | |
| 6-ethoxy-2-naphthaleneboronic acid, 6-ethoxynaphthalen-2-yl boronic acid, 6-ethoxynaphthalene-2-boronic acid, boronic acid, 6-ethoxy-2-naphthalenyl, 2-ethoxy-6-naphthaleneboronic acid, boronic acid, b-6-ethoxy-2-naphthalenyl, 6-ethoxy-2-naphthalenyl-boronic acid, 6-ethoxy-2, acmc-209ies, boronic acid,b-6-ethoxy-2-naphthalenyl | |
| (6-ethoxynaphthalen-2-yl)boronic acid |
| C12H13BO3 | |
| INXXVGFSXYJGHI-UHFFFAOYSA-N | |
| 4641693 | |
| B(C1=CC2=C(C=C1)C=C(C=C2)OCC)(O)O |
Specifications
| 6-Ethoxy-2-naphthaleneboronic acid | |
| 96.0 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| INXXVGFSXYJGHI-UHFFFAOYSA-N | |
| (6-ethoxynaphthalen-2-yl)boronic acid | |
| 4641693 | |
| 97% |
| 352525-98-5 | |
| 100.0 | |
| 96% min. (HPLC) | |
| C12H13BO3 | |
| 6-ethoxy-2-naphthaleneboronic acid, 6-ethoxynaphthalen-2-yl boronic acid, 6-ethoxynaphthalene-2-boronic acid, boronic acid, 6-ethoxy-2-naphthalenyl, 2-ethoxy-6-naphthaleneboronic acid, boronic acid, b-6-ethoxy-2-naphthalenyl, 6-ethoxy-2-naphthalenyl-boronic acid, 6-ethoxy-2, acmc-209ies, boronic acid,b-6-ethoxy-2-naphthalenyl | |
| B(C1=CC2=C(C=C1)C=C(C=C2)OCC)(O)O | |
| 216.04 | |
| 216.04 |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning