missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-Sulfosalicylic Acid, Dihydrate, Crystal, ACS, 99.0-101.0%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor S171050KGBL
Specifications
| 5965-83-3 | |
| 0.001 | |
| C9H14O6S | |
| NFYHZVWMQHQKRU-UHFFFAOYSA-N | |
| 2-hydroxy-5-sulfobenzoic acid; bis(methane) | |
| 99 to 101% | |
| 0.0002 |
| 1 | |
| Amber Glass Bottle | |
| 50 kg | |
| C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O | |
| 250.27 | |
| ACS | |
| Crystalline Powder or Lumps |
Chemical Identifiers
| 5965-83-3 | |
| 250.27 | |
| 2-hydroxy-5-sulfobenzoic acid; bis(methane) |
| C9H14O6S | |
| NFYHZVWMQHQKRU-UHFFFAOYSA-N | |
| C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.