missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(Trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America T17881G
Specifications
| 4-(Trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride) | |
| 250°C | |
| C7H6BF3O2 | |
| 1 g | |
| ALMFIOZYDASRRC-UHFFFAOYSA-N | |
| [4-(trifluoromethyl)phenyl]boronic acid | |
| 2734389 | |
| Crystalline Powder |
| 128796-39-4 | |
| White-Yellow | |
| MFCD00151855 | |
| 4-trifluoromethyl phenylboronic acid, 4-trifluoromethylphenylboronic acid, 4-trifluoromethyl benzeneboronic acid, 4-trifluoromethyl phenyl boronic acid, 4-trifluoromethylphenyl boronic acid, 4-trifluoromethyl phenyl boranediol, 4-boronobenzotrifluoride, p-trifluoromethyl phenylboronic acid, 4-trifluoromethylphenyl-boronic acid | |
| OB(O)C1=CC=C(C=C1)C(F)(F)F | |
| 189.93 | |
| 189.93 |
Chemical Identifiers
| 128796-39-4 | |
| MFCD00151855 | |
| 2734389 |
| C7H6BF3O2 | |
| ALMFIOZYDASRRC-UHFFFAOYSA-N | |
| [4-(trifluoromethyl)phenyl]boronic acid |
Safety and Handling
TSCA : Yes