Learn More
4-(Trifluoromethyl)benzenesulfonyl chloride, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 397760050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-(Trifluoromethyl)benzenesulfonyl chloride | |
| 97.5 | |
| 118°C to 120°C (18.0mmHg) | |
| 97.5% min. (GC) | |
| C7H4ClF3O2S | |
| MFCD00042422 | |
| 4-trifluoromethyl benzenesulfonyl chloride, 4-trifluoromethyl benzene-1-sulfonyl chloride, 4-trifluoromethyl benzene sulfonyl chloride, p-trifluoromethylbenzenesulfonyl chloride, 4-trifluoromethyl benzenesulfonylchloride, 4-trifluoromethyl-benzenesulfonyl chloride, 4-trifluoromethyl phenylsulfonyl chloride, p-trifluoromethyl benzenesulfonyl chloride, 4-trifluoromethyl benzenesulphonyl chloride, benzenesulfonyl chloride, 4-trifluoromethyl | |
| FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O | |
| 244.61 | |
| 244.62 |
| 2991-42-6 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| CF3OC6H4SO2Cl | |
| 5g | |
| OZDCZHDOIBUGAJ-UHFFFAOYSA-N | |
| 4-(trifluoromethyl)benzenesulfonyl chloride | |
| 2777399 | |
| 98% |
Chemical Identifiers
| 2991-42-6 | |
| 244.61 | |
| OZDCZHDOIBUGAJ-UHFFFAOYSA-N | |
| 2777399 | |
| FC(F)(F)C1=CC=C(C=C1)S(Cl)(=O)=O |
| C7H4ClF3O2S | |
| MFCD00042422 | |
| 4-trifluoromethyl benzenesulfonyl chloride, 4-trifluoromethyl benzene-1-sulfonyl chloride, 4-trifluoromethyl benzene sulfonyl chloride, p-trifluoromethylbenzenesulfonyl chloride, 4-trifluoromethyl benzenesulfonylchloride, 4-trifluoromethyl-benzenesulfonyl chloride, 4-trifluoromethyl phenylsulfonyl chloride, p-trifluoromethyl benzenesulfonyl chloride, 4-trifluoromethyl benzenesulphonyl chloride, benzenesulfonyl chloride, 4-trifluoromethyl | |
| 4-(trifluoromethyl)benzenesulfonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Contact with water liberates toxic gas.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call a POISON CENTER or doctor/physician.
IF IN EYES: Rinse cautiously with
GHS Signal Word: Danger
RUO â Research Use Only