Learn More
4-Nitrotoluene, 99%
CAS: 99-99-0 | C7H7NO2 | 137.14 g/mol
Supplier: Thermo Scientific Chemicals 129051000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Nitrotoluene | |
| 99-99-0 | |
| 100.0 | |
| Yellow | |
| 103°C | |
| 99% | |
| C7H7NO2 | |
| MFCD00007366 | |
| 05, 323 | |
| 4-nitrotoluene, p-nitrotoluene, 4-methylnitrobenzene, 4-nitrotoluol, benzene, 1-methyl-4-nitro, toluene, p-nitro, p-methylnitrobenzene, para-nitrotoluol, nitrotoluenos, nitrotoluene, p | |
| ZPTVNYMJQHSSEA-UHFFFAOYSA-N | |
| 1-methyl-4-nitrobenzene | |
| 7473 | |
| 137.14 | |
| Crystalline Solid |
| 99% | |
| 98.5 | |
| 51.0°C to 54.0°C | |
| 238.0°C | |
| Authentic | |
| Glass bottle | |
| CH3C6H4NO2 | |
| 100 g | |
| 15, 6737 | |
| Solubility in water: 0.35g/L (20°C). Other solubilities: soluble in ethanol, ether, benzene, chloroform and, acetone | |
| CC1=CC=C(C=C1)[N+]([O-])=O | |
| 137.14 | |
| CHEBI:35227 | |
| 99% |
Chemical Identifiers
| 99-99-0 | |
| 137.14 | |
| ZPTVNYMJQHSSEA-UHFFFAOYSA-N | |
| 7473 | |
| 1-methyl-4-nitrobenzene |
| C7H7NO2 | |
| MFCD00007366 | |
| 4-nitrotoluene, p-nitrotoluene, 4-methylnitrobenzene, 4-nitrotoluol, benzene, 1-methyl-4-nitro, toluene, p-nitro, p-methylnitrobenzene, para-nitrotoluol, nitrotoluenos, nitrotoluene, p | |
| CHEBI:35227 | |
| CC1=CC=C(C=C1)[N+]([O-])=O |
Safety and Handling
GHS H Statement
May cause damage to organs through prolonged or repeated exposure.
Toxic in contact with skin.
Toxic if inhaled.
Toxic if swallowed.
Toxic to aquatic life with long lasting effects.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a po
GHS Signal Word: Danger
EINECSNumber : 202-808-0
RTECSNumber : XT3325000
TSCA : TSCA
RUO – Research Use Only