missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitroguaiacol 98.0+%, TCI America™
$77.97 - $311.89
Chemical Identifiers
| CAS | 3251-56-7 |
|---|---|
| Molecular Formula | C7H7NO4 |
| Molecular Weight (g/mol) | 169.136 |
| MDL Number | MFCD00012143 |
| InChI Key | IZLVFLOBTPURLP-UHFFFAOYSA-N |
| Synonym | 4-nitroguaiacol, phenol, 2-methoxy-4-nitro, guaiacol, 4-nitro, 2-hydroxy-5-nitroanisole, 3-nitro-6-hydroxyanisole, 4-hydroxy-3-methoxynitrobenzene, phenol, o-methoxy-p-nitro, o-methoxy-p-nitrophenol, 2-methoxy-4-nitro-phenol, 4-nitrogualacol |
| PubChem CID | 76738 |
| ChEBI | CHEBI:81050 |
| IUPAC Name | 2-methoxy-4-nitrophenol |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])O |
Chemical Identifiers
| 3251-56-7 | |
| 169.136 | |
| IZLVFLOBTPURLP-UHFFFAOYSA-N | |
| 76738 | |
| 2-methoxy-4-nitrophenol |
| C7H7NO4 | |
| MFCD00012143 | |
| 4-nitroguaiacol, phenol, 2-methoxy-4-nitro, guaiacol, 4-nitro, 2-hydroxy-5-nitroanisole, 3-nitro-6-hydroxyanisole, 4-hydroxy-3-methoxynitrobenzene, phenol, o-methoxy-p-nitro, o-methoxy-p-nitrophenol, 2-methoxy-4-nitro-phenol, 4-nitrogualacol | |
| CHEBI:81050 | |
| COC1=C(C=CC(=C1)[N+](=O)[O-])O |
Specifications
| 3251-56-7 | |
| C7H7NO4 | |
| 5 g | |
| IZLVFLOBTPURLP-UHFFFAOYSA-N | |
| 2-methoxy-4-nitrophenol | |
| 76738 | |
| 169.14 | |
| Crystalline Powder |
| 103°C | |
| MFCD00012143 | |
| 4-nitroguaiacol, phenol, 2-methoxy-4-nitro, guaiacol, 4-nitro, 2-hydroxy-5-nitroanisole, 3-nitro-6-hydroxyanisole, 4-hydroxy-3-methoxynitrobenzene, phenol, o-methoxy-p-nitro, o-methoxy-p-nitrophenol, 2-methoxy-4-nitro-phenol, 4-nitrogualacol | |
| COC1=C(C=CC(=C1)[N+](=O)[O-])O | |
| 169.136 | |
| CHEBI:81050 | |
| ≥98.0% (GC,T) | |
| 4-Nitroguaiacol |
Safety and Handling
RTECSNumber : SL7800000
TSCA : Yes