Learn More
4-Nitrobenzyl chloroformate, 95%
CAS: 4457-32-3 | C8H6ClNO4 | 215.59 g/mol
$76.90 - $76.90
Chemical Identifiers
| CAS | 4457-32-3 |
|---|---|
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight (g/mol) | 215.59 |
| MDL Number | MFCD00007375 |
| InChI Key | MHSGOABISYIYKP-UHFFFAOYSA-N |
| Synonym | 4-nitrobenzyl chloroformate, 4-nitrobenzyl carbonochloridate, carbonochloridic acid, 4-nitrophenyl methyl ester, 4-nitrobenzyl chlorocarbonate, p-nitrobenzyl chloroformate, 4-nitrocarbobenzoxychloride, 4-nitrophenyl methyl chloroformate, p-nitrobenzyloxycarbonyl chloride, 4-nitrobenzyloxycarbonyl chloride, chloroformic acid p-nitrobenzyl ester |
| PubChem CID | 78205 |
| IUPAC Name | (4-nitrophenyl)methyl carbonochloridate |
| SMILES | C1=CC(=CC=C1COC(=O)Cl)[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC376040050
|
Thermo Scientific Chemicals
376040050 |
5 g |
Each for $76.90
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4457-32-3 | |
| 215.59 | |
| MHSGOABISYIYKP-UHFFFAOYSA-N | |
| 78205 | |
| C1=CC(=CC=C1COC(=O)Cl)[N+](=O)[O-] |
| C8H6ClNO4 | |
| MFCD00007375 | |
| 4-nitrobenzyl chloroformate, 4-nitrobenzyl carbonochloridate, carbonochloridic acid, 4-nitrophenyl methyl ester, 4-nitrobenzyl chlorocarbonate, p-nitrobenzyl chloroformate, 4-nitrocarbobenzoxychloride, 4-nitrophenyl methyl chloroformate, p-nitrobenzyloxycarbonyl chloride, 4-nitrobenzyloxycarbonyl chloride, chloroformic acid p-nitrobenzyl ester | |
| (4-nitrophenyl)methyl carbonochloridate |
Specifications
| 4457-32-3 | |
| 113°C | |
| Glass Bottle | |
| ClCO2CH2C6H4NO2 | |
| MFCD00007375 | |
| 4-nitrobenzyl chloroformate, 4-nitrobenzyl carbonochloridate, carbonochloridic acid, 4-nitrophenyl methyl ester, 4-nitrobenzyl chlorocarbonate, p-nitrobenzyl chloroformate, 4-nitrocarbobenzoxychloride, 4-nitrophenyl methyl chloroformate, p-nitrobenzyloxycarbonyl chloride, 4-nitrobenzyloxycarbonyl chloride, chloroformic acid p-nitrobenzyl ester | |
| C1=CC(=CC=C1COC(=O)Cl)[N+](=O)[O-] | |
| 215.59 | |
| 215.59 | |
| 4-Nitrobenzyl chloroformate |
| 32°C | |
| 94% min. (ex Cl) (Argentometry) | |
| C8H6ClNO4 | |
| 1.5520 to 1.556 | |
| 5 g | |
| MHSGOABISYIYKP-UHFFFAOYSA-N | |
| (4-nitrophenyl)methyl carbonochloridate | |
| 78205 | |
| 95% |
Safety and Handling
GHS H Statement
Toxic if inhaled.
Toxic if swallowed.
Causes serious eye damage.
Toxic in contact with skin.
Causes severe skin burns and eye damage.
Contact with water liberates toxic gas.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF SWALLOWED: rins
GHS Signal Word: Danger
EINECSNumber : 224-708-6
RUO – Research Use Only