missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Nitrobenzyl alcohol, 99%
CAS: 619-73-8 | C7H7NO3 | 153.14 g/mol
$72.65 - $251.82
Chemical Identifiers
| CAS | 619-73-8 |
|---|---|
| Molecular Formula | C7H7NO3 |
| Molecular Weight (g/mol) | 153.14 |
| MDL Number | MFCD00007376 |
| InChI Key | JKTYGPATCNUWKN-UHFFFAOYSA-N |
| Synonym | 4-nitrobenzyl alcohol, 4-nitrophenyl methanol, p-nitrobenzyl alcohol, benzenemethanol, 4-nitro, 4-nitrobenzenemethanol, p-hydroxymethyl nitrobenzene, benzyl alcohol, p-nitro, paranitrobenzyl alcohol, 4-nitrobenzylalcohol, unii-86btj68y9m |
| PubChem CID | 69275 |
| ChEBI | CHEBI:41214 |
| IUPAC Name | (4-nitrophenyl)methanol |
| SMILES | OCC1=CC=C(C=C1)[N+]([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128520250
|
Thermo Scientific Chemicals
128520250 |
25 g | Glass bottle |
Each for $72.65
|
|
||||
|
AC128521000
|
Thermo Scientific Chemicals
128521000 |
100 g | Glass bottle |
Each for $251.82
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 619-73-8 | |
| 153.14 | |
| JKTYGPATCNUWKN-UHFFFAOYSA-N | |
| 69275 | |
| (4-nitrophenyl)methanol |
| C7H7NO3 | |
| MFCD00007376 | |
| 4-nitrobenzyl alcohol, 4-nitrophenyl methanol, p-nitrobenzyl alcohol, benzenemethanol, 4-nitro, 4-nitrobenzenemethanol, p-hydroxymethyl nitrobenzene, benzyl alcohol, p-nitro, paranitrobenzyl alcohol, 4-nitrobenzylalcohol, unii-86btj68y9m | |
| CHEBI:41214 | |
| OCC1=CC=C(C=C1)[N+]([O-])=O |
Specifications
| 619-73-8 | |
| 100.0 | |
| Yellow | |
| 180°C | |
| 99% | |
| C7H7NO3 | |
| MFCD00007376 | |
| 06, 450 | |
| Solubility in water: 2g/L (20°C) | |
| OCC1=CC=C(C=C1)[N+]([O-])=O | |
| 153.14 | |
| CHEBI:41214 | |
| 99% | |
| 4-Nitrobenzyl alcohol, 99% |
| 98.5 | |
| 92.0°C to 95.0°C | |
| 185.0°C (12.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| O2NC6H4CH2OH | |
| 25 g | |
| 4-nitrobenzyl alcohol, 4-nitrophenyl methanol, p-nitrobenzyl alcohol, benzenemethanol, 4-nitro, 4-nitrobenzenemethanol, p-hydroxymethyl nitrobenzene, benzyl alcohol, p-nitro, paranitrobenzyl alcohol, 4-nitrobenzylalcohol, unii-86btj68y9m | |
| JKTYGPATCNUWKN-UHFFFAOYSA-N | |
| (4-nitrophenyl)methanol | |
| 69275 | |
| 153.14 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plen
GHS Signal Word: Warning
EINECSNumber : 210-611-6
RTECSNumber : DP0657100
TSCA : TSCA
RUO – Research Use Only