Learn More
4-Nitrobenzyl alcohol, 99%
CAS: 619-73-8 | C7H7NO3 | 153.14 g/mol
Supplier: Thermo Scientific Chemicals 128520250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Nitrobenzyl alcohol | |
| 619-73-8 | |
| 100.0 | |
| Yellow | |
| 180°C | |
| 99% | |
| C7H7NO3 | |
| MFCD00007376 | |
| 06, 450 | |
| Solubility in water: 2g/L (20°C) | |
| OCC1=CC=C(C=C1)[N+]([O-])=O | |
| 153.14 | |
| CHEBI:41214 | |
| 99% |
| 99% | |
| 98.5 | |
| 92.0°C to 95.0°C | |
| 185.0°C (12.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| O2NC6H4CH2OH | |
| 25 g | |
| 4-nitrobenzyl alcohol, 4-nitrophenyl methanol, p-nitrobenzyl alcohol, benzenemethanol, 4-nitro, 4-nitrobenzenemethanol, p-hydroxymethyl nitrobenzene, benzyl alcohol, p-nitro, paranitrobenzyl alcohol, 4-nitrobenzylalcohol, unii-86btj68y9m | |
| JKTYGPATCNUWKN-UHFFFAOYSA-N | |
| (4-nitrophenyl)methanol | |
| 69275 | |
| 153.14 | |
| Crystalline Powder |
Chemical Identifiers
| 619-73-8 | |
| 153.14 | |
| JKTYGPATCNUWKN-UHFFFAOYSA-N | |
| 69275 | |
| (4-nitrophenyl)methanol |
| C7H7NO3 | |
| MFCD00007376 | |
| 4-nitrobenzyl alcohol, 4-nitrophenyl methanol, p-nitrobenzyl alcohol, benzenemethanol, 4-nitro, 4-nitrobenzenemethanol, p-hydroxymethyl nitrobenzene, benzyl alcohol, p-nitro, paranitrobenzyl alcohol, 4-nitrobenzylalcohol, unii-86btj68y9m | |
| CHEBI:41214 | |
| OCC1=CC=C(C=C1)[N+]([O-])=O |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plen
GHS Signal Word: Warning
EINECSNumber : 210-611-6
RTECSNumber : DP0657100
TSCA : TSCA
RUO – Research Use Only