Learn More
4-Nitrobenzaldehyde, 99%
CAS: 555-16-8 | C7H5NO3 | 151.12 g/mol
$106.30 - $794.65
Chemical Identifiers
| CAS | 555-16-8 |
|---|---|
| Molecular Formula | C7H5NO3 |
| Molecular Weight (g/mol) | 151.12 |
| MDL Number | MFCD00007346 |
| InChI Key | BXRFQSNOROATLV-UHFFFAOYSA-N |
| Synonym | p-nitrobenzaldehyde, benzaldehyde, 4-nitro, p-formylnitrobenzene, benzaldehyde, p-nitro, 4-nitrobenzaldehydde, 4-nitro-benzaldehyde, 4-formylnitrobenzene, p-nitro benzaldehyde, 4-nitro benzaldehyde, ccris 1675 |
| PubChem CID | 541 |
| ChEBI | CHEBI:66926 |
| IUPAC Name | 4-nitrobenzaldehyde |
| SMILES | [O-][N+](=O)C1=CC=C(C=O)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC156990250
|
Thermo Scientific Chemicals
156990250 |
25 g | Plastic bottle |
Each for $106.30
|
|
||||
|
AC156991000
|
Thermo Scientific Chemicals
156991000 |
100 g | Plastic bottle |
Each for $269.05
|
|
||||
|
AC156995000
|
Thermo Scientific Chemicals
156995000 |
500 g | Plastic bottle |
Each for $794.65
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 555-16-8 | |
| 151.12 | |
| BXRFQSNOROATLV-UHFFFAOYSA-N | |
| 541 | |
| 4-nitrobenzaldehyde |
| C7H5NO3 | |
| MFCD00007346 | |
| p-nitrobenzaldehyde, benzaldehyde, 4-nitro, p-formylnitrobenzene, benzaldehyde, p-nitro, 4-nitrobenzaldehydde, 4-nitro-benzaldehyde, 4-formylnitrobenzene, p-nitro benzaldehyde, 4-nitro benzaldehyde, ccris 1675 | |
| CHEBI:66926 | |
| [O-][N+](=O)C1=CC=C(C=O)C=C1 |
Specifications
| 555-16-8 | |
| Yellow to Brown | |
| 99% | |
| C7H5NO3 | |
| MFCD00007346 | |
| 07,256 | |
| p-nitrobenzaldehyde, benzaldehyde, 4-nitro, p-formylnitrobenzene, benzaldehyde, p-nitro, 4-nitrobenzaldehydde, 4-nitro-benzaldehyde, 4-formylnitrobenzene, p-nitro benzaldehyde, 4-nitro benzaldehyde, ccris 1675 | |
| BXRFQSNOROATLV-UHFFFAOYSA-N | |
| 4-nitrobenzaldehyde | |
| 541 | |
| 151.12 | |
| Crystalline Powder |
| 105.0°C to 106.0°C | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4CHO | |
| 25 g | |
| 14,6587 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in glacial acetic acid,soluble in alcohol and benzene,slightly soluble in ether | |
| [O-][N+](=O)C1=CC=C(C=O)C=C1 | |
| 151.12 | |
| CHEBI:66926 | |
| 99% | |
| 4-Nitrobenzaldehyde |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Causes serious eye irritation.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
IF ON SKIN:
GHS Signal Word: Warning
EINECSNumber : 209-084-5
RUO – Research Use Only