missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America M28391G
Specifications
| 4-Methoxy-3-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride) | |
| 202°C | |
| C8H8BF3O3 | |
| 1 g | |
| BUSMBMGODABSIN-UHFFFAOYSA-N | |
| [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid | |
| 17750052 | |
| Crystalline Powder |
| 149507-36-8 | |
| White | |
| MFCD07363790 | |
| 4-methoxy-3-trifluoromethyl phenyl boronic acid, 4-methoxy-3-trifluoromethylphenylboronic acid, 3-trifluoromethyl-4-methoxy-phenylboronic acid, 4-methoxy-3-trifluoromethylphenyl boronic acid, 4-methoxy-3-trifluoromethyl benzeneboronic acid, 4-methoxy-3-trifluoromethyl phenylboronic acid, boronic acid, 4-methoxy-3-trifluoromethyl phenyl, acmc-1c5ik | |
| B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O | |
| 219.954 | |
| 219.95 |
Chemical Identifiers
| 149507-36-8 | |
| 219.954 | |
| BUSMBMGODABSIN-UHFFFAOYSA-N | |
| 17750052 | |
| B(C1=CC(=C(C=C1)OC)C(F)(F)F)(O)O |
| C8H8BF3O3 | |
| MFCD07363790 | |
| 4-methoxy-3-trifluoromethyl phenyl boronic acid, 4-methoxy-3-trifluoromethylphenylboronic acid, 3-trifluoromethyl-4-methoxy-phenylboronic acid, 4-methoxy-3-trifluoromethylphenyl boronic acid, 4-methoxy-3-trifluoromethyl benzeneboronic acid, 4-methoxy-3-trifluoromethyl phenylboronic acid, boronic acid, 4-methoxy-3-trifluoromethyl phenyl, acmc-1c5ik | |
| [4-methoxy-3-(trifluoromethyl)phenyl]boronic acid |
Safety and Handling
TSCA : No