missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Fluorophenyl sulfone, 99%
CAS: 383-29-9 | C12H8F2O2S | 254.25 g/mol
Supplier: Thermo Scientific Chemicals 119620250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Fluorophenyl sulfone | |
| 98.5 | |
| 97.0°C to 100.0°C | |
| Authentic | |
| Glass bottle | |
| (FC6H4)2SO2 | |
| 25 g | |
| PLVUIVUKKJTSDM-UHFFFAOYSA-N | |
| 1-fluoro-4-(4-fluorophenyl)sulfonylbenzene | |
| 67842 | |
| 99% |
| 383-29-9 | |
| 100.0 | |
| Brown to White | |
| 99% | |
| C12H8F2O2S | |
| MFCD00000350 | |
| 4-fluorophenyl sulfone, bis p-fluorophenyl sulfone, 4,4'-sulfonylbis fluorobenzene, bis 4-fluorophenyl sulfone, 4,4'-difluorodiphenyl sulfone, 4-fluorophenyl sulphone, 4-fluorophenylsulfone, benzene, 1,1'-sulfonylbis 4-fluoro, 4,4'-difluorodiphenyl sulphone | |
| FC1=CC=C(C=C1)S(=O)(=O)C1=CC=C(F)C=C1 | |
| 254.25 | |
| 254.25 | |
| Crystals or Powder |
Chemical Identifiers
| 383-29-9 | |
| 254.25 | |
| PLVUIVUKKJTSDM-UHFFFAOYSA-N | |
| 67842 | |
| FC1=CC=C(C=C1)S(=O)(=O)C1=CC=C(F)C=C1 |
| C12H8F2O2S | |
| MFCD00000350 | |
| 4-fluorophenyl sulfone, bis p-fluorophenyl sulfone, 4,4'-sulfonylbis fluorobenzene, bis 4-fluorophenyl sulfone, 4,4'-difluorodiphenyl sulfone, 4-fluorophenyl sulphone, 4-fluorophenylsulfone, benzene, 1,1'-sulfonylbis 4-fluoro, 4,4'-difluorodiphenyl sulphone | |
| 1-fluoro-4-(4-fluorophenyl)sulfonylbenzene |
Safety and Handling
EINECSNumber : 206-847-4
RUO – Research Use Only