missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Chlorobenzhydrol, 98%
CAS: 119-56-2 | C13H11ClO | 218.68 g/mol
$76.96 - $681.41
Chemical Identifiers
| CAS | 119-56-2 |
|---|---|
| Molecular Formula | C13H11ClO |
| Molecular Weight (g/mol) | 218.68 |
| MDL Number | MFCD00004491 |
| InChI Key | AJYOOHCNOXWTKJ-UHFFFAOYSA-N |
| Synonym | 4-chlorobenzhydrol, 4-chlorophenyl phenyl methanol, p-chlorobenzhydrol, chlorobenzhydrol, benzhydrol, p-chloro, 4-chlorodiphenylmethanol, benzhydrol, 4-chloro, 4-chlorophenyl phenylmethanol, 4-chlorobenzhydryl alcohol, benzenemethanol, 4-chloro-.alpha.-phenyl |
| PubChem CID | 8401 |
| ChEBI | CHEBI:35091 |
| IUPAC Name | (4-chlorophenyl)-phenylmethanol |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2369106
|
Thermo Scientific Chemicals
B2369106 |
5 g |
Each for $76.96
|
|
|||||
|
AAB2369114
|
Thermo Scientific Chemicals
B2369114 |
25 g |
Each for $234.78
|
|
|||||
|
AAB2369122
|
Thermo Scientific Chemicals
B2369122 |
100 g |
Each for $681.41
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 119-56-2 | |
| 218.68 | |
| AJYOOHCNOXWTKJ-UHFFFAOYSA-N | |
| 8401 | |
| (4-chlorophenyl)-phenylmethanol |
| C13H11ClO | |
| MFCD00004491 | |
| 4-chlorobenzhydrol, 4-chlorophenyl phenyl methanol, p-chlorobenzhydrol, chlorobenzhydrol, benzhydrol, p-chloro, 4-chlorodiphenylmethanol, benzhydrol, 4-chloro, 4-chlorophenyl phenylmethanol, 4-chlorobenzhydryl alcohol, benzenemethanol, 4-chloro-.alpha.-phenyl | |
| CHEBI:35091 | |
| C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)O |
Specifications
| 119-56-2 | |
| 150°C to 151°C (2.6 mmHg) | |
| MFCD00004491 | |
| 2050235 | |
| AJYOOHCNOXWTKJ-UHFFFAOYSA-N | |
| (4-chlorophenyl)-phenylmethanol | |
| 8401 | |
| 218.68 | |
| 4-Chlorobenzhydrol |
| 58°C to 62°C | |
| C13H11ClO | |
| 5 g | |
| 4-chlorobenzhydrol, 4-chlorophenyl phenyl methanol, p-chlorobenzhydrol, chlorobenzhydrol, benzhydrol, p-chloro, 4-chlorodiphenylmethanol, benzhydrol, 4-chloro, 4-chlorophenyl phenylmethanol, 4-chlorobenzhydryl alcohol, benzenemethanol, 4-chloro-.alpha.-phenyl | |
| C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)O | |
| 218.68 | |
| CHEBI:35091 | |
| 98% |
Safety and Handling
EINECSNumber : 204-333-4
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only