missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Bromodiphenyl Ether 98.0+%, TCI America™
$76.32 - $829.51
Chemical Identifiers
| CAS | 101-55-3 |
|---|---|
| Molecular Formula | C12H9BrO |
| Molecular Weight (g/mol) | 249.107 |
| MDL Number | MFCD00000094 |
| InChI Key | JDUYPUMQALQRCN-UHFFFAOYSA-N |
| Synonym | 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl |
| PubChem CID | 7565 |
| ChEBI | CHEBI:77421 |
| IUPAC Name | 1-bromo-4-phenoxybenzene |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Chemical Identifiers
| 101-55-3 | |
| 249.107 | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 7565 | |
| 1-bromo-4-phenoxybenzene |
| C12H9BrO | |
| MFCD00000094 | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| CHEBI:77421 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Specifications
| 101-55-3 | |
| 305°C | |
| MFCD00000094 | |
| 3082 | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 1-bromo-4-phenoxybenzene | |
| 7565 | |
| 249.11 | |
| Liquid |
| Yellow | |
| C12H9BrO | |
| 25 g | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br | |
| 249.107 | |
| CHEBI:77421 | |
| ≥98.0% (GC) | |
| 4-Bromodiphenyl Ether |
Safety and Handling
EINECSNumber : (3)-0061
TSCA : Yes