missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Bromo-DL-phenylalanine, 99%, Thermo Scientific™
Chemical Identifiers
| CAS | 14091-15-7 |
|---|---|
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight (g/mol) | 244.09 |
| MDL Number | MFCD00002599 |
| InChI Key | PEMUHKUIQHFMTH-UHFFFAOYSA-N |
| Synonym | 2-amino-3-4-bromophenyl propanoic acid, p-bromo-dl-phenylalanine, 4-bromo-dl-phenylalanine, dl-4-br-phe-oh, 4-bromophenylalanine, 4-bromo-phenylalanine, h-dl-phe 4-br-oh, 2-amino-3-4-bromophenyl propionic acid, 2-amino-3-4-bromo-phenyl-propionic acid, p-br-phenylalanine |
| PubChem CID | 85681 |
| IUPAC Name | 2-amino-3-(4-bromophenyl)propanoic acid |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)Br |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC227792500
|
Thermo Scientific Chemicals
227792500 |
250mg | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 14091-15-7 | |
| 244.09 | |
| PEMUHKUIQHFMTH-UHFFFAOYSA-N | |
| 85681 | |
| C1=CC(=CC=C1CC(C(=O)O)N)Br |
| C9H10BrNO2 | |
| MFCD00002599 | |
| 2-amino-3-4-bromophenyl propanoic acid, p-bromo-dl-phenylalanine, 4-bromo-dl-phenylalanine, dl-4-br-phe-oh, 4-bromophenylalanine, 4-bromo-phenylalanine, h-dl-phe 4-br-oh, 2-amino-3-4-bromophenyl propionic acid, 2-amino-3-4-bromo-phenyl-propionic acid, p-br-phenylalanine | |
| 2-amino-3-(4-bromophenyl)propanoic acid |
Specifications
| 14091-15-7 | |
| 100.0 | |
| 99% | |
| C9H10BrNO2 | |
| MFCD00002599 | |
| 2-amino-3-4-bromophenyl propanoic acid, p-bromo-dl-phenylalanine, 4-bromo-dl-phenylalanine, dl-4-br-phe-oh, 4-bromophenylalanine, 4-bromo-phenylalanine, h-dl-phe 4-br-oh, 2-amino-3-4-bromophenyl propionic acid, 2-amino-3-4-bromo-phenyl-propionic acid, p-br-phenylalanine | |
| C1=CC(=CC=C1CC(C(=O)O)N)Br | |
| 244.09 | |
| 244.09 | |
| 4-Bromo-DL-phenylalanine, 99% |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| BrC6H4CH2CH(NH2)CO2H | |
| 250mg | |
| PEMUHKUIQHFMTH-UHFFFAOYSA-N | |
| 2-amino-3-(4-bromophenyl)propanoic acid | |
| 85681 | |
| 99% |
Safety and Handling
EINECSNumber : 237-941-3
RUO â Research Use Only