missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Bromo-DL-phenylalanine, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 227792500
| Quantity | 250mg |
|---|---|
| Packaging | Glass bottle |
Chemical Identifiers
| 14091-15-7 | |
| 244.09 | |
| PEMUHKUIQHFMTH-UHFFFAOYSA-N | |
| 85681 | |
| C1=CC(=CC=C1CC(C(=O)O)N)Br |
| C9H10BrNO2 | |
| MFCD00002599 | |
| 2-amino-3-4-bromophenyl propanoic acid, p-bromo-dl-phenylalanine, 4-bromo-dl-phenylalanine, dl-4-br-phe-oh, 4-bromophenylalanine, 4-bromo-phenylalanine, h-dl-phe 4-br-oh, 2-amino-3-4-bromophenyl propionic acid, 2-amino-3-4-bromo-phenyl-propionic acid, p-br-phenylalanine | |
| 2-amino-3-(4-bromophenyl)propanoic acid |
Specifications
| 4-Bromo-DL-phenylalanine | |
| 14091-15-7 | |
| 100.0 | |
| 99% | |
| C9H10BrNO2 | |
| 250mg | |
| 2-amino-3-4-bromophenyl propanoic acid, p-bromo-dl-phenylalanine, 4-bromo-dl-phenylalanine, dl-4-br-phe-oh, 4-bromophenylalanine, 4-bromo-phenylalanine, h-dl-phe 4-br-oh, 2-amino-3-4-bromophenyl propionic acid, 2-amino-3-4-bromo-phenyl-propionic acid, p-br-phenylalanine | |
| C1=CC(=CC=C1CC(C(=O)O)N)Br | |
| 244.09 | |
| 244.09 |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| BrC6H4CH2CH(NH2)CO2H | |
| MFCD00002599 | |
| PEMUHKUIQHFMTH-UHFFFAOYSA-N | |
| 2-amino-3-(4-bromophenyl)propanoic acid | |
| 85681 | |
| 99% |
Safety and Handling
EINECSNumber : 237-941-3
Promotions
Expires: 06-30-2027
Get Up to $1,800 in Chemicals with Purchase
Spend $250 or more on Thermo Fisher Scientific chemicals and get up to $1,800 to spend on additional chemicals.