missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,4'-Dimethylbenzophenone, 98+%
CAS: 611-97-2 | C15H14O | 210.28 g/mol
$29.91 - $161.87
Chemical Identifiers
| CAS | 611-97-2 |
|---|---|
| Molecular Formula | C15H14O |
| Molecular Weight (g/mol) | 210.28 |
| MDL Number | MFCD00017214 |
| InChI Key | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| Synonym | 4,4'-dimethylbenzophenone, p-tolyl ketone, bis 4-methylphenyl methanone, di-p-tolyl ketone, methanone, bis 4-methylphenyl, p,p'-dimethylbenzophenone, p,p'-dimethyl di-phenyl ketone, bis-p-tolylmethanone, benzophenone, 4,4'-dimethyl, 4,4-dimethylbenzophenone |
| PubChem CID | 69148 |
| IUPAC Name | bis(4-methylphenyl)methanone |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC408220010
|
Thermo Scientific Chemicals
408220010 |
1 g | Glass bottle |
Each for $29.91
|
|
||||
|
AC408220100
|
Thermo Scientific Chemicals
408220100 |
10 g | Glass bottle |
Each for $161.87
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 611-97-2 | |
| 210.28 | |
| ZWPWLKXZYNXATK-UHFFFAOYSA-N | |
| 69148 | |
| CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
| C15H14O | |
| MFCD00017214 | |
| 4,4'-dimethylbenzophenone, p-tolyl ketone, bis 4-methylphenyl methanone, di-p-tolyl ketone, methanone, bis 4-methylphenyl, p,p'-dimethylbenzophenone, p,p'-dimethyl di-phenyl ketone, bis-p-tolylmethanone, benzophenone, 4,4'-dimethyl, 4,4-dimethylbenzophenone | |
| bis(4-methylphenyl)methanone |
Specifications
| 611-97-2 | |
| 100.0 | |
| Brown | |
| Authentic | |
| Glass bottle | |
| MFCD00017214 | |
| 4,4'-dimethylbenzophenone, p-tolyl ketone, bis 4-methylphenyl methanone, di-p-tolyl ketone, methanone, bis 4-methylphenyl, p,p'-dimethylbenzophenone, p,p'-dimethyl di-phenyl ketone, bis-p-tolylmethanone, benzophenone, 4,4'-dimethyl, 4,4-dimethylbenzophenone | |
| CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C | |
| 210.28 | |
| 210.28 | |
| Crystalline Powder |
| 98.0 | |
| 93°C to 97°C | |
| 200°C (17.0 mmHg) | |
| 98% min. (GC) | |
| C15H14O | |
| 1 g | |
| ZWPWLKXZYNXATK-UHFFFAOYSA-N | |
| bis(4-methylphenyl)methanone | |
| 69148 | |
| 98+% | |
| 4,4′-Dimethylbenzophenone |
Safety and Handling
EINECSNumber : 210-287-6
RUO – Research Use Only