missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Dichlorobenzophenone 99.0+%, TCI America™
$77.97 - $930.70
Chemical Identifiers
| CAS | 90-98-2 |
|---|---|
| Molecular Formula | C13H8Cl2O |
| Molecular Weight (g/mol) | 251.11 |
| MDL Number | MFCD00000623 |
| InChI Key | OKISUZLXOYGIFP-UHFFFAOYSA-N |
| Synonym | 4,4'-dichlorobenzophenone, bis 4-chlorophenyl methanone, methanone, bis 4-chlorophenyl, bis 4-chlorophenyl ketone, dcbp, di p-chlorophenyl ketone, di 4-chlorophenyl ketone, bis p-chlorophenyl ketone, p,p'-dichlorobenzophenone, usaf do-4 |
| PubChem CID | 7034 |
| ChEBI | CHEBI:27519 |
| IUPAC Name | bis(4-chlorophenyl)methanone |
| SMILES | ClC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1 |
Chemical Identifiers
| 90-98-2 | |
| 251.11 | |
| OKISUZLXOYGIFP-UHFFFAOYSA-N | |
| 7034 | |
| bis(4-chlorophenyl)methanone |
| C13H8Cl2O | |
| MFCD00000623 | |
| 4,4'-dichlorobenzophenone, bis 4-chlorophenyl methanone, methanone, bis 4-chlorophenyl, bis 4-chlorophenyl ketone, dcbp, di p-chlorophenyl ketone, di 4-chlorophenyl ketone, bis p-chlorophenyl ketone, p,p'-dichlorobenzophenone, usaf do-4 | |
| CHEBI:27519 | |
| ClC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1 |
Specifications
| 90-98-2 | |
| White-Yellow | |
| C13H8Cl2O | |
| 25 g | |
| OKISUZLXOYGIFP-UHFFFAOYSA-N | |
| bis(4-chlorophenyl)methanone | |
| 7034 | |
| 251.11 | |
| Crystalline Powder |
| 147°C | |
| 353°C | |
| MFCD00000623 | |
| 4,4'-dichlorobenzophenone, bis 4-chlorophenyl methanone, methanone, bis 4-chlorophenyl, bis 4-chlorophenyl ketone, dcbp, di p-chlorophenyl ketone, di 4-chlorophenyl ketone, bis p-chlorophenyl ketone, p,p'-dichlorobenzophenone, usaf do-4 | |
| ClC1=CC=C(C=C1)C(=O)C1=CC=C(Cl)C=C1 | |
| 251.11 | |
| CHEBI:27519 | |
| ≥99.0% (GC) | |
| 4,4′-Dichlorobenzophenone |
Safety and Handling
EINECSNumber : (4)-0128
RTECSNumber : DJ0525000
TSCA : Yes