missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4,5,5-Tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane 98.0+%, TCI America™
Supplier: TCI America N10061G
Specifications
| 4,4,5,5-Tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane | |
| 47°C | |
| C12H16BNO4 | |
| 1 g | |
| VLJYUDGCEKORNG-UHFFFAOYSA-N | |
| 4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane | |
| 3699568 | |
| ≥98.0% (GC,T) |
| 190788-59-1 | |
| White-Yellow | |
| MFCD02179447 | |
| 4,4,5,5-tetramethyl-2-2-nitrophenyl-1,3,2-dioxaborolane, 2-nitrobenzeneboronic acid pinacol ester, 2-nitrophenyl boronic acid pinacol ester, 2-nitrophenylboronic acid pinacol ester, 1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-2-nitrophenyl, 2-2-nitrophenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl nitrobenzene, amtb916, 2-nitrophenyl boronic acid, pinacol ester, 2-nitrophenylboronic acid, pinacol ester | |
| CC1(C)OB(OC1(C)C)C1=CC=CC=C1[N+]([O-])=O | |
| 249.07 | |
| 249.07 | |
| Crystalline Powder |
Chemical Identifiers
| 190788-59-1 | |
| 249.07 | |
| VLJYUDGCEKORNG-UHFFFAOYSA-N | |
| 3699568 | |
| CC1(C)OB(OC1(C)C)C1=CC=CC=C1[N+]([O-])=O |
| C12H16BNO4 | |
| MFCD02179447 | |
| 4,4,5,5-tetramethyl-2-2-nitrophenyl-1,3,2-dioxaborolane, 2-nitrobenzeneboronic acid pinacol ester, 2-nitrophenyl boronic acid pinacol ester, 2-nitrophenylboronic acid pinacol ester, 1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-2-nitrophenyl, 2-2-nitrophenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl nitrobenzene, amtb916, 2-nitrophenyl boronic acid, pinacol ester, 2-nitrophenylboronic acid, pinacol ester | |
| 4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane |
Safety and Handling
TSCA : No