missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-(Trifluoromethyl)benzenesulfonyl chloride, 95%, Thermo Scientific™
$40.45 - $40.45
Chemical Identifiers
| CAS | 777-44-6 |
|---|---|
| Molecular Formula | C7H4ClF3O2S |
| Molecular Weight (g/mol) | 244.62 |
| MDL Number | MFCD00014724 |
| InChI Key | ONCAZCNPWWQQMW-UHFFFAOYSA-N |
| Synonym | 3-trifluoromethyl benzenesulfonyl chloride, 3-trifluoromethyl benzene-1-sulfonyl chloride, m-trifluoromethylbenzenesulfonyl chloride, 3-trifluoromethyl benzenesulphonyl chloride, 3-trifluoromethylbenzenesulfochloride, 3-trifluoromethyl benzenesulfonylchloride, benzenesulfonyl chloride, 3-trifluoromethyl, 3-chlorosulphonyl benzotrifluoride, m-trifluoromethylphenylsulfonyl chloride, 3-trifluoromethyl-benzenesulfonyl chloride |
| PubChem CID | 2733250 |
| IUPAC Name | 3-(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC306280010
|
Thermo Scientific Chemicals
306280010 |
1 g | Glass bottle |
Each for $40.45
|
|
||||
Chemical Identifiers
| 777-44-6 | |
| 244.62 | |
| ONCAZCNPWWQQMW-UHFFFAOYSA-N | |
| 2733250 | |
| C1=CC(=CC(=C1)S(=O)(=O)Cl)C(F)(F)F |
| C7H4ClF3O2S | |
| MFCD00014724 | |
| 3-trifluoromethyl benzenesulfonyl chloride, 3-trifluoromethyl benzene-1-sulfonyl chloride, m-trifluoromethylbenzenesulfonyl chloride, 3-trifluoromethyl benzenesulphonyl chloride, 3-trifluoromethylbenzenesulfochloride, 3-trifluoromethyl benzenesulfonylchloride, benzenesulfonyl chloride, 3-trifluoromethyl, 3-chlorosulphonyl benzotrifluoride, m-trifluoromethylphenylsulfonyl chloride, 3-trifluoromethyl-benzenesulfonyl chloride | |
| 3-(trifluoromethyl)benzenesulfonyl chloride |
Specifications
| 777-44-6 | |
| 100.0 | |
| 1.5200g/mL | |
| >110°C | |
| 94% min. (GC) | |
| C7H4ClF3O2S | |
| CF3C6H4SO2Cl | |
| 1 g | |
| 3-trifluoromethyl benzenesulfonyl chloride, 3-trifluoromethyl benzene-1-sulfonyl chloride, m-trifluoromethylbenzenesulfonyl chloride, 3-trifluoromethyl benzenesulphonyl chloride, 3-trifluoromethylbenzenesulfochloride, 3-trifluoromethyl benzenesulfonylchloride, benzenesulfonyl chloride, 3-trifluoromethyl, 3-chlorosulphonyl benzotrifluoride, m-trifluoromethylphenylsulfonyl chloride, 3-trifluoromethyl-benzenesulfonyl chloride | |
| ONCAZCNPWWQQMW-UHFFFAOYSA-N | |
| 3-(trifluoromethyl)benzenesulfonyl chloride | |
| 2733250 | |
| 95% | |
| 3-(Trifluoromethyl)benzenesulfonyl chloride, 95% |
| 94.0 | |
| Yellow to Brown | |
| 77°C to 79°C (0.8 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4847 to 1.4867 | |
| MFCD00014724 | |
| 1.52 | |
| Solubility in water: reacts | |
| C1=CC(=CC(=C1)S(=O)(=O)Cl)C(F)(F)F | |
| 244.62 | |
| 244.62 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
TSCA : TSCA
RUO – Research Use Only