Learn More
3-Nitrophenol, 99%
CAS: 554-84-7 | C6H5NO3 | 139.11 g/mol
Supplier: Thermo Scientific Chemicals 172300100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 3-Nitrophenol | |
| 94.0°C to 98.0°C | |
| 1.4900g/mL | |
| Authentic | |
| Glass bottle | |
| O2NC6H4OH | |
| 10 g | |
| 1.49 | |
| m-nitrophenol, 3-hydroxynitrobenzene, m-hydroxynitrobenzene, phenol, 3-nitro, phenol, m-nitro, m-nitrofenol, meta-nitrophenol, 3-nitro-phenol, m-nitrofenol czech, 1-hydroxy-3-nitrobenzene | |
| RTZZCYNQPHTPPL-UHFFFAOYSA-N | |
| 3-nitrophenol | |
| 11137 | |
| 139.11 | |
| Crystalline Powder |
| 554-84-7 | |
| Yellow to Brown | |
| 194.0°C (70.0 mmHg) | |
| 98.5% min. (GC) | |
| C6H5NO3 | |
| MFCD00007240 | |
| 06,222 | |
| 15,6706 | |
| Solubility in water: 13.5g/L (25°C). Other solubilities: soluble 700g/L in ethanol (20°C),soluble in benzene,diethyl ether,alcohol,,hot and diluted solutions,insoluble in petroleum ehter | |
| OC1=CC=CC(=C1)[N+]([O-])=O | |
| 139.11 | |
| CHEBI:34346 | |
| 99% |
Chemical Identifiers
| 554-84-7 | |
| 139.11 | |
| RTZZCYNQPHTPPL-UHFFFAOYSA-N | |
| 11137 | |
| 3-nitrophenol |
| C6H5NO3 | |
| MFCD00007240 | |
| m-nitrophenol, 3-hydroxynitrobenzene, m-hydroxynitrobenzene, phenol, 3-nitro, phenol, m-nitro, m-nitrofenol, meta-nitrophenol, 3-nitro-phenol, m-nitrofenol czech, 1-hydroxy-3-nitrobenzene | |
| CHEBI:34346 | |
| OC1=CC=CC(=C1)[N+]([O-])=O |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye damage.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing.
Wear prote
GHS Signal Word: Danger
EINECSNumber : 209-073-5
RUO – Research Use Only