missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Nitrobenzyl Alcohol 99.0+%, TCI America™
Supplier: TCI America S03781G
Specifications
| 3-Nitrobenzyl Alcohol [Matrix for FABMS and liquid SIMS] | |
| C7H7NO3 | |
| 1 g | |
| CWNPOQFCIIFQDM-UHFFFAOYSA-N | |
| (3-nitrophenyl)methanol | |
| 69267 | |
| ≥99.0% (GC) |
| 619-25-0 | |
| MFCD00007273 | |
| 3-nitrobenzyl alcohol, 3-nitrophenyl methanol, m-nitrobenzyl alcohol, benzenemethanol, 3-nitro, benzyl alcohol, m-nitro, 3-nitrobenzenemethanol, unii-f829x990iv, ccris 7971, 3-nitrophenyl methan-1-ol, 3-nitrobenzylalcohol | |
| C1=CC(=CC(=C1)[N+](=O)[O-])CO | |
| 153.137 | |
| 153.14 | |
| Crystals |
Chemical Identifiers
| 619-25-0 | |
| 153.137 | |
| CWNPOQFCIIFQDM-UHFFFAOYSA-N | |
| 69267 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])CO |
| C7H7NO3 | |
| MFCD00007273 | |
| 3-nitrobenzyl alcohol, 3-nitrophenyl methanol, m-nitrobenzyl alcohol, benzenemethanol, 3-nitro, benzyl alcohol, m-nitro, 3-nitrobenzenemethanol, unii-f829x990iv, ccris 7971, 3-nitrophenyl methan-1-ol, 3-nitrobenzylalcohol | |
| (3-nitrophenyl)methanol |
Safety and Handling
RTECSNumber : DP0657000
TSCA : Yes