missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 3-Iodo-L-tyrosine, 97%
CAS: 70-78-0 | C9H10INO3 | 307.09 g/mol
$314.14
Chemical Identifiers
| CAS | 70-78-0 |
|---|---|
| Molecular Formula | C9H10INO3 |
| Molecular Weight (g/mol) | 307.09 |
| MDL Number | MFCD00002608 |
| InChI Key | UQTZMGFTRHFAAM-JLDDOWRYNA-N |
| Synonym | 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine |
| PubChem CID | 439744 |
| ChEBI | CHEBI:27847 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| SMILES | N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|
AC122440050
|
Thermo Scientific Chemicals
122440050 |
5 g | Glass Bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 70-78-0 | |
| 307.09 | |
| UQTZMGFTRHFAAM-JLDDOWRYNA-N | |
| 439744 | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| C9H10INO3 | |
| MFCD00002608 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| CHEBI:27847 | |
| N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O |
Specifications
| 196.0°C to 198.0°C | |
| 96.0 | |
| White | |
| Authentic | |
| C9H10INO3 | |
| − 3.18 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| 1% max. (K.F.) | |
| N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O | |
| 307.09 | |
| CHEBI:27847 | |
| 97% | |
| 3-Iodo-L-tyrosine |
| 70-78-0 | |
| 100.0 | |
| 20ppm max. | |
| 97% | |
| MFCD00002608 | |
| 15, 5090 | |
| Solubility in water: .. Other solubilities: soluble in 15 parts boiling water | |
| UQTZMGFTRHFAAM-JLDDOWRYNA-N | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | |
| 439744 | |
| 307.08 | |
| Powder |
RUO – Research Use Only