missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 3-Iodo-L-tyrosine, 97%
CAS: 70-78-0 | C9H10INO3 | 307.09 g/mol
Supplier: Thermo Scientific Chemicals 122440050
| Quantity | 5 g |
|---|---|
| Packaging | Glass Bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 70-78-0 | |
| 307.09 | |
| UQTZMGFTRHFAAM-JLDDOWRYNA-N | |
| 439744 | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| C9H10INO3 | |
| MFCD00002608 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| CHEBI:27847 | |
| N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O |
Specifications
| 196.0°C to 198.0°C | |
| 70-78-0 | |
| 100.0 | |
| 20ppm max. | |
| 97% | |
| C9H10INO3 | |
| − 3.18 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| 1% max. (K.F.) | |
| N[C@@H](CC1=CC=C(O)C(I)=C1)C(O)=O | |
| 5 g | |
| 439744 | |
| 307.08 | |
| Powder |
| 3-Iodo-L-tyrosine | |
| 96.0 | |
| White | |
| Authentic | |
| Glass Bottle | |
| MFCD00002608 | |
| 15, 5090 | |
| Solubility in water: .. Other solubilities: soluble in 15 parts boiling water | |
| UQTZMGFTRHFAAM-JLDDOWRYNA-N | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | |
| 307.09 | |
| CHEBI:27847 | |
| 97% |