missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific™ 3-Iodo-L-tyrosine, 97%
Supplier: Thermo Scientific™ 122440050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 3-Iodo-L-tyrosine | |
| 96.0 | |
| 20ppm max. | |
| 97% | |
| Glass bottle | |
| − 3.18 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| UQTZMGFTRHFAAM-ZETCQYMHSA-N | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | |
| 307.087 | |
| CHEBI:27847 | |
| 97% |
| 70-78-0 | |
| 100.0 | |
| Authentic | |
| C9H10INO3 | |
| MFCD00002608 | |
| 15, 5090 | |
| 1% max. (K.F.) | |
| C1=CC(=C(C=C1CC(C(=O)O)N)I)O | |
| 5g | |
| 439744 | |
| 307.08 |
Chemical Identifiers
| 70-78-0 | |
| 307.087 | |
| UQTZMGFTRHFAAM-ZETCQYMHSA-N | |
| 439744 | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| C9H10INO3 | |
| MFCD00002608 | |
| 3-iodo-l-tyrosine, h-tyr 3-i-oh, 3-iodo-tyrosine, monoiodotyrosine, iodotyrosine, 3-monoiodo-l-tyrosine, l-tyrosine, 3-iodo, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid, 3-iodotyrosine, 3-iodo-4-hydroxyphenylalanine | |
| CHEBI:27847 | |
| C1=CC(=C(C=C1CC(C(=O)O)N)I)O |
RUO â Research Use Only