missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Hydroxy-2,2,4-trimethylpentyl Isobutyrate 60.0+%, TCI America™
(contains ca. 40% 2,2,4-Trimethyl-1,3-pentanediol 3-Monoisobutyrate)
Supplier: TCI America I0405500ML
Specifications
| 3-Hydroxy-2,2,4-trimethylpentyl Isobutyrate (contains ca. 40% 2,2,4-Trimethyl-1,3-pentanediol 3-Mono | |
| -50°C | |
| 253°C | |
| MFCD00148967 | |
| texanol, 2,2,4-trimethyl-1,3-pentanediol monoisobutyrate, chissocizer cs 12, propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester, 2,2,4-trimethylpentane-1,3-diol monoisobutyrate, 3-hydroxy-2,2,4-trimethylpentyl isobutyrate, ccris 8966, isobutyraldehyde tishchenko trimer, propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol, 2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate | |
| CC(C)C(C(C)(C)COC(=O)C(C)C)O | |
| 216.321 | |
| 216.32 | |
| Liquid |
| 25265-77-4 | |
| Yellow | |
| C12H24O3 | |
| 500 mL | |
| DAFHKNAQFPVRKR-UHFFFAOYSA-N | |
| (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate | |
| 6490 | |
| ≥60.0% (GC) |
Chemical Identifiers
| 25265-77-4 | |
| 216.321 | |
| DAFHKNAQFPVRKR-UHFFFAOYSA-N | |
| 6490 | |
| CC(C)C(C(C)(C)COC(=O)C(C)C)O |
| C12H24O3 | |
| MFCD00148967 | |
| texanol, 2,2,4-trimethyl-1,3-pentanediol monoisobutyrate, chissocizer cs 12, propanoic acid, 2-methyl-, 3-hydroxy-2,2,4-trimethylpentyl ester, 2,2,4-trimethylpentane-1,3-diol monoisobutyrate, 3-hydroxy-2,2,4-trimethylpentyl isobutyrate, ccris 8966, isobutyraldehyde tishchenko trimer, propanoic acid, 2-methyl-, monoester with 2,2,4-trimethyl-1,3-pentanediol, 2,2,4-trimethyl-1,3-pentanediolmono 2-methylpropanoate | |
| (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate |
Safety and Handling
EINECSNumber : (2)-0778
RTECSNumber : UF6000000
TSCA : Yes